C25H29N3OS — CID 23992378
1-[3-[2-(2,6-dimethylphenyl)imino-4-(4-methylphenyl)-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one (PubChem CID 23992378) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-[3-[2-(2,6-dimethylphenyl)imino-4-(4-methylphenyl)-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-(2,6-dimethylphenyl)imino-4-(4-methylphenyl)-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23992378 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[3-[2-(2,6-dimethylphenyl)imino-4-(4-methylphenyl)-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(-c2cs/c(=N\c3c(C)cccc3C)n2CCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C25H29N3OS/c1-18-10-12-21(13-11-18)22-17-30-25(26-24-19(2)7-4-8-20(24)3)28(22)16-6-15-27-14-5-9-23(27)29/h4,7-8,10-13,17H,5-6,9,14-16H2,1-3H3/b26-25- |
| InChIKey | BMWZMCTYCVCXCT-QPLCGJKRSA-N |
| XLogP | 5.39 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|