C26H28Cl2N4O4S2 — CID 23990167
1-[3-[4-(2,4-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one (PubChem CID 23990167) has the molecular formula C26H28Cl2N4O4S2 and a molecular weight of 595.57 g/mol. Its IUPAC name is 1-[3-[4-(2,4-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-(2,4-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23990167 |
| Molecular Formula | C26H28Cl2N4O4S2 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | 1-[3-[4-(2,4-dichlorophenyl)-2-(4-morpholin-4-ylsulfonylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCn1c(-c2ccc(Cl)cc2Cl)cs/c1=N/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28Cl2N4O4S2/c27-19-4-9-22(23(28)17-19)24-18-37-26(32(24)12-2-11-30-10-1-3-25(30)33)29-20-5-7-21(8-6-20)38(34,35)31-13-15-36-16-14-31/h4-9,17-18H,1-3,10-16H2/b29-26+ |
| InChIKey | BXBGJQZGQLLRRO-PBBVDAKRSA-N |
| XLogP | 4.79 |
| TPSA | 84.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|