C24H24Cl2N4O3S2 — CID 23989036
3-(cyclopentylideneamino)-4-(3,4-dichlorophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23989036) has the molecular formula C24H24Cl2N4O3S2 and a molecular weight of 551.52 g/mol. Its IUPAC name is 3-(cyclopentylideneamino)-4-(3,4-dichlorophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclopentylideneamino)-4-(3,4-dichlorophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23989036 |
| Molecular Formula | C24H24Cl2N4O3S2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 3-(cyclopentylideneamino)-4-(3,4-dichlorophenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(/N=c2/scc(-c3ccc(Cl)c(Cl)c3)n2N=C2CCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H24Cl2N4O3S2/c25-21-10-5-17(15-22(21)26)23-16-34-24(30(23)28-19-3-1-2-4-19)27-18-6-8-20(9-7-18)35(31,32)29-11-13-33-14-12-29/h5-10,15-16H,1-4,11-14H2/b27-24+ |
| InChIKey | SUKNLTWZZJYARL-SOYKGTTHSA-N |
| XLogP | 5.55 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|