C28H30N4O3S2 — CID 23731648
3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(4-methylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23731648) has the molecular formula C28H30N4O3S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(4-methylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(4-methylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23731648 |
| Molecular Formula | C28H30N4O3S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(4-methylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2N=CC2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C28H30N4O3S2/c1-20-2-5-22(6-3-20)27-19-36-28(32(27)29-18-24-17-21-4-7-23(24)16-21)30-25-8-10-26(11-9-25)37(33,34)31-12-14-35-15-13-31/h2-11,18-19,21,23-24H,12-17H2,1H3/b29-18?,30-28- |
| InChIKey | ZNTOYRISLWARJT-DNAPFHOSSA-N |
| XLogP | 4.82 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|