C26H30N4O3S2 — CID 23761600
3-(cyclopentylideneamino)-4-(3,4-dimethylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23761600) has the molecular formula C26H30N4O3S2 and a molecular weight of 510.69 g/mol. Its IUPAC name is 3-(cyclopentylideneamino)-4-(3,4-dimethylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclopentylideneamino)-4-(3,4-dimethylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23761600 |
| Molecular Formula | C26H30N4O3S2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 3-(cyclopentylideneamino)-4-(3,4-dimethylphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2cs/c(=N/c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2N=C2CCCC2)cc1C |
| InChI | InChI=1S/C26H30N4O3S2/c1-19-7-8-21(17-20(19)2)25-18-34-26(30(25)28-23-5-3-4-6-23)27-22-9-11-24(12-10-22)35(31,32)29-13-15-33-16-14-29/h7-12,17-18H,3-6,13-16H2,1-2H3/b27-26+ |
| InChIKey | PTKHDDXMVOXWKY-CYYJNZCTSA-N |
| XLogP | 4.86 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|