C24H28N4O5S2 — CID 23881931
N-(4-morpholin-4-ylsulfonylphenyl)-4-(4-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine (PubChem CID 23881931) has the molecular formula C24H28N4O5S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-4-(4-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-4-(4-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23881931 |
| Molecular Formula | C24H28N4O5S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-4-(4-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine |
| SMILES | CCCC(C)n1c(-c2ccc([N+](=O)[O-])cc2)cs/c1=N\c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28N4O5S2/c1-3-4-18(2)27-23(19-5-9-21(10-6-19)28(29)30)17-34-24(27)25-20-7-11-22(12-8-20)35(31,32)26-13-15-33-16-14-26/h5-12,17-18H,3-4,13-16H2,1-2H3/b25-24- |
| InChIKey | IEVKMSWNUXBLRO-IZHYLOQSSA-N |
| XLogP | 4.74 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|