C25H27N3O5S2 — CID 4003578
4-(1-benzofuran-2-yl)-3-(1-methoxypropan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 4003578) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-(1-methoxypropan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-(1-methoxypropan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4003578 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-(1-methoxypropan-2-yl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | COCC(C)n1c(-c2cc3ccccc3o2)cs/c1=N\c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H27N3O5S2/c1-18(16-31-2)28-22(24-15-19-5-3-4-6-23(19)33-24)17-34-25(28)26-20-7-9-21(10-8-20)35(29,30)27-11-13-32-14-12-27/h3-10,15,17-18H,11-14,16H2,1-2H3/b26-25- |
| InChIKey | RFUPXOMSGZTPOJ-QPLCGJKRSA-N |
| XLogP | 4.42 |
| TPSA | 86.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|