C28H24N4O4S2 — CID 23851500
4-(1-benzofuran-2-yl)-3-(benzylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23851500) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-(benzylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-(benzylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23851500 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-(benzylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(/N=c2\scc(-c3cc4ccccc4o3)n2N=Cc2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H24N4O4S2/c33-38(34,31-14-16-35-17-15-31)24-12-10-23(11-13-24)30-28-32(29-19-21-6-2-1-3-7-21)25(20-37-28)27-18-22-8-4-5-9-26(22)36-27/h1-13,18-20H,14-17H2/b29-19?,30-28- |
| InChIKey | VUXQZKKUTAWRFI-RPGJXRFVSA-N |
| XLogP | 5.10 |
| TPSA | 89.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|