C28H24N6O5S2 — CID 135814478
3-(1H-indol-3-ylmethylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 135814478) has the molecular formula C28H24N6O5S2 and a molecular weight of 588.67 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(1H-indol-3-ylmethylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135814478 |
| Molecular Formula | C28H24N6O5S2 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 3-(1H-indol-3-ylmethylideneamino)-N-(4-morpholin-4-ylsulfonylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cccc(-c2cs/c(=N\c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2N=Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C28H24N6O5S2/c35-34(36)23-5-3-4-20(16-23)27-19-40-28(33(27)30-18-21-17-29-26-7-2-1-6-25(21)26)31-22-8-10-24(11-9-22)41(37,38)32-12-14-39-15-13-32/h1-11,16-19,29H,12-15H2/b30-18?,31-28- |
| InChIKey | XAZLXILXJYVUPN-DLJXSQCTSA-N |
| XLogP | 4.74 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|