C23H18N4S2 — CID 135799806
3-(1H-indol-3-ylmethylideneamino)-N-(3-methylphenyl)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 135799806) has the molecular formula C23H18N4S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethylideneamino)-N-(3-methylphenyl)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(1H-indol-3-ylmethylideneamino)-N-(3-methylphenyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135799806 |
| Molecular Formula | C23H18N4S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-(1H-indol-3-ylmethylideneamino)-N-(3-methylphenyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(/N=c2\scc(-c3cccs3)n2N=Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C23H18N4S2/c1-16-6-4-7-18(12-16)26-23-27(21(15-29-23)22-10-5-11-28-22)25-14-17-13-24-20-9-3-2-8-19(17)20/h2-15,24H,1H3/b25-14?,26-23- |
| InChIKey | BVSXJYVNGOWNFB-JQMFECEZSA-N |
| XLogP | 6.18 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|