C13H13N5 — CID 135558233
(E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1H-indol-3-yl)methanimine (PubChem CID 135558233) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1H-indol-3-yl)methanimine.
| Compound Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 135558233 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1H-indol-3-yl)methanimine |
| SMILES | Cc1nnc(C)n1/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H13N5/c1-9-16-17-10(2)18(9)15-8-11-7-14-13-6-4-3-5-12(11)13/h3-8,14H,1-2H3/b15-8+ |
| InChIKey | WXGSQEGFESXEQI-OVCLIPMQSA-N |
| XLogP | 2.26 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|