C15H17N5 — CID 2550408
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(7-ethyl-1H-indol-3-yl)methanimine (PubChem CID 2550408) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(7-ethyl-1H-indol-3-yl)methanimine.
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(7-ethyl-1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 2550408 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(7-ethyl-1H-indol-3-yl)methanimine |
| SMILES | CCc1cccc2c(C=Nn3c(C)nnc3C)c[nH]c12 |
| InChI | InChI=1S/C15H17N5/c1-4-12-6-5-7-14-13(8-16-15(12)14)9-17-20-10(2)18-19-11(20)3/h5-9,16H,4H2,1-3H3 |
| InChIKey | UGCFIXDNKLANHU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|