C16H19N5 — CID 10468938
3-(2-pyrrolidin-1-ylethyl)-5-(1,2,4-triazol-4-yl)-1H-indole (PubChem CID 10468938) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylethyl)-5-(1,2,4-triazol-4-yl)-1H-indole.
| Compound Name | 3-(2-pyrrolidin-1-ylethyl)-5-(1,2,4-triazol-4-yl)-1H-indole |
|---|---|
| PubChem CID | 10468938 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylethyl)-5-(1,2,4-triazol-4-yl)-1H-indole |
| SMILES | c1cc2[nH]cc(CCN3CCCC3)c2cc1-n1cnnc1 |
| InChI | InChI=1S/C16H19N5/c1-2-7-20(6-1)8-5-13-10-17-16-4-3-14(9-15(13)16)21-11-18-19-12-21/h3-4,9-12,17H,1-2,5-8H2 |
| InChIKey | WYXPLVWYFDBFBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |