C11H9N5 — CID 135614731
(E)-1-(1H-indol-3-yl)-N-(1,2,4-triazol-1-yl)methanimine (PubChem CID 135614731) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is (E)-1-(1H-indol-3-yl)-N-(1,2,4-triazol-1-yl)methanimine.
| Compound Name | (E)-1-(1H-indol-3-yl)-N-(1,2,4-triazol-1-yl)methanimine |
|---|---|
| PubChem CID | 135614731 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (E)-1-(1H-indol-3-yl)-N-(1,2,4-triazol-1-yl)methanimine |
| SMILES | C(=N/n1cncn1)\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H9N5/c1-2-4-11-10(3-1)9(5-13-11)6-14-16-8-12-7-15-16/h1-8,13H/b14-6+ |
| InChIKey | ZLUXXYHIJPELTH-MKMNVTDBSA-N |
| XLogP | 1.64 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|