C32H26N4 — CID 177388523
1-(1H-indol-3-yl)-N-[4-[2-[4-(1H-indol-3-ylmethylideneamino)phenyl]ethyl]phenyl]methanimine (PubChem CID 177388523) has the molecular formula C32H26N4 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-[4-[2-[4-(1H-indol-3-ylmethylideneamino)phenyl]ethyl]phenyl]methanimine.
| Compound Name | 1-(1H-indol-3-yl)-N-[4-[2-[4-(1H-indol-3-ylmethylideneamino)phenyl]ethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 177388523 |
| Molecular Formula | C32H26N4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-[4-[2-[4-(1H-indol-3-ylmethylideneamino)phenyl]ethyl]phenyl]methanimine |
| SMILES | C(=N/c1ccc(CCc2ccc(/N=C/c3c[nH]c4ccccc34)cc2)cc1)\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C32H26N4/c1-3-7-31-29(5-1)25(21-35-31)19-33-27-15-11-23(12-16-27)9-10-24-13-17-28(18-14-24)34-20-26-22-36-32-8-4-2-6-30(26)32/h1-8,11-22,35-36H,9-10H2/b33-19+,34-20+ |
| InChIKey | OQTOOQYJMDBXHJ-ZXHXELASSA-N |
| XLogP | 7.94 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|