C28H20N4 — CID 135686999
N-phenyl-1-[1-(phenyliminomethyl)-3,8-dihydroindolo[7,6-g]indol-6-yl]methanimine (PubChem CID 135686999) has the molecular formula C28H20N4 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-phenyl-1-[1-(phenyliminomethyl)-3,8-dihydroindolo[7,6-g]indol-6-yl]methanimine.
| Compound Name | N-phenyl-1-[1-(phenyliminomethyl)-3,8-dihydroindolo[7,6-g]indol-6-yl]methanimine |
|---|---|
| PubChem CID | 135686999 |
| Molecular Formula | C28H20N4 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-phenyl-1-[1-(phenyliminomethyl)-3,8-dihydroindolo[7,6-g]indol-6-yl]methanimine |
| SMILES | C(=N/c1ccccc1)\c1c[nH]c2c1ccc1c2ccc2c(/C=N/c3ccccc3)c[nH]c21 |
| InChI | InChI=1S/C28H20N4/c1-3-7-21(8-4-1)29-15-19-17-31-27-23(19)11-13-26-25(27)14-12-24-20(18-32-28(24)26)16-30-22-9-5-2-6-10-22/h1-18,31-32H/b29-15+,30-16+ |
| InChIKey | CXAGRWBWTBXUIK-CMNXJCJSSA-N |
| XLogP | 7.30 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|