C13H11N — CID 10858
N,1-diphenylmethanimine (PubChem CID 10858) has the molecular formula C13H11N and a molecular weight of 181.24 g/mol. Its IUPAC name is N,1-diphenylmethanimine.
| Compound Name | N,1-diphenylmethanimine |
|---|---|
| PubChem CID | 10858 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N,1-diphenylmethanimine |
| SMILES | C(=N/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C13H11N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-11H/b14-11+ |
| InChIKey | UVEWQKMPXAHFST-SDNWHVSQSA-N |
| XLogP | 3.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|