C25H19N — CID 141288310
N,1-bis(3-phenylphenyl)methanimine (PubChem CID 141288310) has the molecular formula C25H19N and a molecular weight of 333.43 g/mol. Its IUPAC name is N,1-bis(3-phenylphenyl)methanimine.
| Compound Name | N,1-bis(3-phenylphenyl)methanimine |
|---|---|
| PubChem CID | 141288310 |
| Molecular Formula | C25H19N |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N,1-bis(3-phenylphenyl)methanimine |
| SMILES | C(=N/c1cccc(-c2ccccc2)c1)\c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H19N/c1-3-10-21(11-4-1)23-14-7-9-20(17-23)19-26-25-16-8-15-24(18-25)22-12-5-2-6-13-22/h1-19H/b26-19+ |
| InChIKey | FZDPBGUZDDYMHK-LGUFXXKBSA-N |
| XLogP | 6.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|