C17H16N2 — CID 693741
N-(2,5-dimethylphenyl)-1-(1H-indol-3-yl)methanimine (PubChem CID 693741) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-(1H-indol-3-yl)methanimine.
| Compound Name | N-(2,5-dimethylphenyl)-1-(1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 693741 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-(1H-indol-3-yl)methanimine |
| SMILES | Cc1ccc(C)c(/N=C/c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C17H16N2/c1-12-7-8-13(2)17(9-12)19-11-14-10-18-16-6-4-3-5-15(14)16/h3-11,18H,1-2H3/b19-11+ |
| InChIKey | PFROVLAYVAJYHF-YBFXNURJSA-N |
| XLogP | 4.54 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|