C18H19N3O2S — CID 136873473
N-[(E)-1H-indol-3-ylmethylideneamino]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 136873473) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 136873473 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/N=C/c2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12-8-13(2)18(14(3)9-12)24(22,23)21-20-11-15-10-19-17-7-5-4-6-16(15)17/h4-11,19,21H,1-3H3/b20-11+ |
| InChIKey | HFTVDUKJMFTWJB-RGVLZGJSSA-N |
| XLogP | 3.41 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|