C14H16N2O2S2 — CID 110516904
2,4,6-trimethyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide (PubChem CID 110516904) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110516904 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2,4,6-trimethyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/N=C/c2cccs2)c(C)c1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-10-7-11(2)14(12(3)8-10)20(17,18)16-15-9-13-5-4-6-19-13/h4-9,16H,1-3H3/b15-9+ |
| InChIKey | BCAHZEABGOWEDF-OQLLNIDSSA-N |
| XLogP | 2.99 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|