C13H14N2O4S2 — CID 110517561
3,4-dimethoxy-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide (PubChem CID 110517561) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110517561 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3,4-dimethoxy-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2cccs2)cc1OC |
| InChI | InChI=1S/C13H14N2O4S2/c1-18-12-6-5-11(8-13(12)19-2)21(16,17)15-14-9-10-4-3-7-20-10/h3-9,15H,1-2H3/b14-9+ |
| InChIKey | OKTIRZMTUYRDKL-NTEUORMPSA-N |
| XLogP | 2.08 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|