C16H19BN2O4S — CID 67451502
[3-[(Z)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 67451502) has the molecular formula C16H19BN2O4S and a molecular weight of 346.22 g/mol. Its IUPAC name is [3-[(Z)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [3-[(Z)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 67451502 |
| Molecular Formula | C16H19BN2O4S |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [3-[(Z)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/N=C\c2cccc(B(O)O)c2)c(C)c1 |
| InChI | InChI=1S/C16H19BN2O4S/c1-11-7-12(2)16(13(3)8-11)24(22,23)19-18-10-14-5-4-6-15(9-14)17(20)21/h4-10,19-21H,1-3H3/b18-10- |
| InChIKey | CNCIYFHRILXDLV-ZDLGFXPLSA-N |
| XLogP | 0.60 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|