C22H19N3O2S — CID 1379937
N-[2-(1H-indol-3-ylmethylideneamino)phenyl]-4-methylbenzenesulfonamide (PubChem CID 1379937) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[2-(1H-indol-3-ylmethylideneamino)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(1H-indol-3-ylmethylideneamino)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1379937 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[2-(1H-indol-3-ylmethylideneamino)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2/N=C/c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H19N3O2S/c1-16-10-12-18(13-11-16)28(26,27)25-22-9-5-4-8-21(22)24-15-17-14-23-20-7-3-2-6-19(17)20/h2-15,23,25H,1H3/b24-15+ |
| InChIKey | BDCJLWCVMJOTKN-BUVRLJJBSA-N |
| XLogP | 5.03 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|