C26H24N4O4S2 — CID 102274853
4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]diazenyl]phenyl]benzenesulfonamide (PubChem CID 102274853) has the molecular formula C26H24N4O4S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]diazenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]diazenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102274853 |
| Molecular Formula | C26H24N4O4S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]diazenyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2/N=N/c2ccccc2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O4S2/c1-19-11-15-21(16-12-19)35(31,32)29-25-9-5-3-7-23(25)27-28-24-8-4-6-10-26(24)30-36(33,34)22-17-13-20(2)14-18-22/h3-18,29-30H,1-2H3/b28-27+ |
| InChIKey | CFUSJNLMWCLQTR-BYYHNAKLSA-N |
| XLogP | 6.32 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|