C20H21N3O4S2 — CID 39977625
1-N-methyl-4-N-[2-(4-methylanilino)phenyl]benzene-1,4-disulfonamide (PubChem CID 39977625) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-N-methyl-4-N-[2-(4-methylanilino)phenyl]benzene-1,4-disulfonamide.
| Compound Name | 1-N-methyl-4-N-[2-(4-methylanilino)phenyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 39977625 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-N-methyl-4-N-[2-(4-methylanilino)phenyl]benzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccccc2Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O4S2/c1-15-7-9-16(10-8-15)22-19-5-3-4-6-20(19)23-29(26,27)18-13-11-17(12-14-18)28(24,25)21-2/h3-14,21-23H,1-2H3 |
| InChIKey | XVZKVOZNGFWRPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |