C29H27N5O6S2 — CID 12073591
4-methyl-N-[2-[[(Z)-3-[2-[(4-methylphenyl)sulfonylamino]phenyl]imino-2-nitroprop-1-enyl]amino]phenyl]benzenesulfonamide (PubChem CID 12073591) has the molecular formula C29H27N5O6S2 and a molecular weight of 605.70 g/mol. Its IUPAC name is 4-methyl-N-[2-[[(Z)-3-[2-[(4-methylphenyl)sulfonylamino]phenyl]imino-2-nitroprop-1-enyl]amino]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[[(Z)-3-[2-[(4-methylphenyl)sulfonylamino]phenyl]imino-2-nitroprop-1-enyl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 12073591 |
| Molecular Formula | C29H27N5O6S2 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | 4-methyl-N-[2-[[(Z)-3-[2-[(4-methylphenyl)sulfonylamino]phenyl]imino-2-nitroprop-1-enyl]amino]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2/N=C/C(=C/Nc2ccccc2NS(=O)(=O)c2ccc(C)cc2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H27N5O6S2/c1-21-11-15-24(16-12-21)41(37,38)32-28-9-5-3-7-26(28)30-19-23(34(35)36)20-31-27-8-4-6-10-29(27)33-42(39,40)25-17-13-22(2)14-18-25/h3-20,30,32-33H,1-2H3/b23-19-,31-20+ |
| InChIKey | PVWJZOYQNIRAQZ-KQTGGMAVSA-N |
| XLogP | 5.84 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|