C20H18ClNO2S — CID 172728368
N-[2-[chloro(phenyl)methyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 172728368) has the molecular formula C20H18ClNO2S and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[2-[chloro(phenyl)methyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[chloro(phenyl)methyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 172728368 |
| Molecular Formula | C20H18ClNO2S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[2-[chloro(phenyl)methyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18ClNO2S/c1-15-11-13-17(14-12-15)25(23,24)22-19-10-6-5-9-18(19)20(21)16-7-3-2-4-8-16/h2-14,20,22H,1H3 |
| InChIKey | HLMFMQXWXFHIAM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|