C24H24N2 — CID 134109201
N-(2,5-dimethylphenyl)-1-[4-[(2,5-dimethylphenyl)iminomethyl]phenyl]methanimine (PubChem CID 134109201) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-[4-[(2,5-dimethylphenyl)iminomethyl]phenyl]methanimine.
| Compound Name | N-(2,5-dimethylphenyl)-1-[4-[(2,5-dimethylphenyl)iminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 134109201 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-[4-[(2,5-dimethylphenyl)iminomethyl]phenyl]methanimine |
| SMILES | Cc1ccc(C)c(/N=C/c2ccc(/C=N/c3cc(C)ccc3C)cc2)c1 |
| InChI | InChI=1S/C24H24N2/c1-17-5-7-19(3)23(13-17)25-15-21-9-11-22(12-10-21)16-26-24-14-18(2)6-8-20(24)4/h5-16H,1-4H3/b25-15+,26-16+ |
| InChIKey | IRKGFJJEHAIAHQ-RYQLWAFASA-N |
| XLogP | 6.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|