C15H15NO2 — CID 780515
4-[(2,5-dimethylphenyl)iminomethyl]benzene-1,2-diol (PubChem CID 780515) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[(2,5-dimethylphenyl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 780515 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)iminomethyl]benzene-1,2-diol |
| SMILES | Cc1ccc(C)c(/N=C/c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C15H15NO2/c1-10-3-4-11(2)13(7-10)16-9-12-5-6-14(17)15(18)8-12/h3-9,17-18H,1-2H3/b16-9+ |
| InChIKey | YIAAJTLWTPJLCE-CXUHLZMHSA-N |
| XLogP | 3.47 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|