C16H16BrNO — CID 3639370
2-bromo-6-[(2,5-dimethylphenyl)iminomethyl]-4-methylphenol (PubChem CID 3639370) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-bromo-6-[(2,5-dimethylphenyl)iminomethyl]-4-methylphenol.
| Compound Name | 2-bromo-6-[(2,5-dimethylphenyl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 3639370 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-bromo-6-[(2,5-dimethylphenyl)iminomethyl]-4-methylphenol |
| SMILES | Cc1cc(Br)c(O)c(/C=N/c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C16H16BrNO/c1-10-4-5-12(3)15(8-10)18-9-13-6-11(2)7-14(17)16(13)19/h4-9,19H,1-3H3/b18-9+ |
| InChIKey | HFPPVAXCZXDBHC-GIJQJNRQSA-N |
| XLogP | 4.83 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|