C16H15N2O3- — CID 7067911
2-[(2,5-dimethylphenyl)iminomethyl]-4-methyl-6-nitrophenolate (PubChem CID 7067911) has the molecular formula C16H15N2O3- and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)iminomethyl]-4-methyl-6-nitrophenolate.
| Compound Name | 2-[(2,5-dimethylphenyl)iminomethyl]-4-methyl-6-nitrophenolate |
|---|---|
| PubChem CID | 7067911 |
| Molecular Formula | C16H15N2O3- |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)iminomethyl]-4-methyl-6-nitrophenolate |
| SMILES | Cc1ccc(C)c(/N=C/c2cc(C)cc([N+](=O)[O-])c2[O-])c1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-4-5-12(3)14(7-10)17-9-13-6-11(2)8-15(16(13)19)18(20)21/h4-9,19H,1-3H3/p-1/b17-9+ |
| InChIKey | MSPDBHNIIXHEFV-RQZCQDPDSA-M |
| XLogP | 3.34 |
| TPSA | 78.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|