C32H30N6NiO6 — CID 139055982
2-[(5-methyl-2-oxidophenyl)iminomethyl]-4,6-dinitrophenolate;tris(3-methylpyridine);nickel(2+) (PubChem CID 139055982) has the molecular formula C32H30N6NiO6 and a molecular weight of 653.32 g/mol. Its IUPAC name is 2-[(5-methyl-2-oxidophenyl)iminomethyl]-4,6-dinitrophenolate;tris(3-methylpyridine);nickel(2+).
| Compound Name | 2-[(5-methyl-2-oxidophenyl)iminomethyl]-4,6-dinitrophenolate;tris(3-methylpyridine);nickel(2+) |
|---|---|
| PubChem CID | 139055982 |
| Molecular Formula | C32H30N6NiO6 |
| Molecular Weight | 653.32 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 2-[(5-methyl-2-oxidophenyl)iminomethyl]-4,6-dinitrophenolate;tris(3-methylpyridine);nickel(2+) |
| SMILES | Cc1ccc([O-])c(/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2[O-])c1.Cc1cccnc1.Cc1cccnc1.Cc1cccnc1.[Ni+2] |
| InChI | InChI=1S/C14H11N3O6.3C6H7N.Ni/c1-8-2-3-13(18)11(4-8)15-7-9-5-10(16(20)21)6-12(14(9)19)17(22)23;3*1-6-3-2-4-7-5-6;/h2-7,18-19H,1H3;3*2-5H,1H3;/q;;;;+2/p-2/b15-7+;;;; |
| InChIKey | HBVSAIVXKJFDRR-GIBVBMLNSA-L |
| XLogP | 5.88 |
| TPSA | 183.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|