C13H13N5O8 — CID 44887172
N,N-dimethylpyridin-3-amine oxide;2,4,6-trinitrophenol (PubChem CID 44887172) has the molecular formula C13H13N5O8 and a molecular weight of 367.27 g/mol. Its IUPAC name is N,N-dimethylpyridin-3-amine oxide;2,4,6-trinitrophenol.
| Compound Name | N,N-dimethylpyridin-3-amine oxide;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 44887172 |
| Molecular Formula | C13H13N5O8 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N,N-dimethylpyridin-3-amine oxide;2,4,6-trinitrophenol |
| SMILES | C[N+](C)([O-])c1cccnc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H10N2O.C6H3N3O7/c1-9(2,10)7-4-3-5-8-6-7;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-6H,1-2H3;1-2,10H |
| InChIKey | OFTLVTSLSYJTQU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 185.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|