C9H9BrO — CID 177021092
2-bromo-6-ethenyl-4-methylphenol (PubChem CID 177021092) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is 2-bromo-6-ethenyl-4-methylphenol.
| Compound Name | 2-bromo-6-ethenyl-4-methylphenol |
|---|---|
| PubChem CID | 177021092 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 2-bromo-6-ethenyl-4-methylphenol |
| SMILES | C=Cc1cc(C)cc(Br)c1O |
| InChI | InChI=1S/C9H9BrO/c1-3-7-4-6(2)5-8(10)9(7)11/h3-5,11H,1H2,2H3 |
| InChIKey | LIDGWDINECRYCS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |