C12H16N5O+ — CID 140931974
[[(E)-N'-[(3-ethenyl-2-hydroxy-5-methylphenyl)methylideneamino]carbamimidoyl]amino]-methylideneazanium (PubChem CID 140931974) has the molecular formula C12H16N5O+ and a molecular weight of 246.29 g/mol. Its IUPAC name is [[(E)-N'-[(3-ethenyl-2-hydroxy-5-methylphenyl)methylideneamino]carbamimidoyl]amino]-methylideneazanium.
| Compound Name | [[(E)-N'-[(3-ethenyl-2-hydroxy-5-methylphenyl)methylideneamino]carbamimidoyl]amino]-methylideneazanium |
|---|---|
| PubChem CID | 140931974 |
| Molecular Formula | C12H16N5O+ |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [[(E)-N'-[(3-ethenyl-2-hydroxy-5-methylphenyl)methylideneamino]carbamimidoyl]amino]-methylideneazanium |
| SMILES | C=Cc1cc(C)cc(C=N/N=C(\N)N[NH+]=C)c1O |
| InChI | InChI=1S/C12H15N5O/c1-4-9-5-8(2)6-10(11(9)18)7-15-17-12(13)16-14-3/h4-7,18H,1,3H2,2H3,(H3,13,16,17)/p+1 |
| InChIKey | DTWJONMLNIOJSF-UHFFFAOYSA-O |
| XLogP | -0.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|