C14H10Br3NO2 — CID 4630820
2-bromo-6-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-4-methylphenol (PubChem CID 4630820) has the molecular formula C14H10Br3NO2 and a molecular weight of 463.95 g/mol. Its IUPAC name is 2-bromo-6-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-4-methylphenol.
| Compound Name | 2-bromo-6-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 4630820 |
| Molecular Formula | C14H10Br3NO2 |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 460.83 |
| IUPAC Name | 2-bromo-6-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-4-methylphenol |
| SMILES | Cc1cc(Br)c(O)c(/C=N/c2cc(Br)c(O)c(Br)c2)c1 |
| InChI | InChI=1S/C14H10Br3NO2/c1-7-2-8(13(19)10(15)3-7)6-18-9-4-11(16)14(20)12(17)5-9/h2-6,19-20H,1H3/b18-6+ |
| InChIKey | NCZWROIKKVHBBV-NGYBGAFCSA-N |
| XLogP | 5.44 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|