C15H13Cl2NO — CID 709091
2,4-dichloro-6-[(3,5-dimethylphenyl)iminomethyl]phenol (PubChem CID 709091) has the molecular formula C15H13Cl2NO and a molecular weight of 294.18 g/mol. Its IUPAC name is 2,4-dichloro-6-[(3,5-dimethylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(3,5-dimethylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 709091 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2,4-dichloro-6-[(3,5-dimethylphenyl)iminomethyl]phenol |
| SMILES | Cc1cc(C)cc(/N=C/c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C15H13Cl2NO/c1-9-3-10(2)5-13(4-9)18-8-11-6-12(16)7-14(17)15(11)19/h3-8,19H,1-2H3/b18-8+ |
| InChIKey | MPRCPMNECOCXIH-QGMBQPNBSA-N |
| XLogP | 5.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|