C16H15Cl2NO2 — CID 4662873
2,4-dichloro-6-[(4-propoxyphenyl)iminomethyl]phenol (PubChem CID 4662873) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(4-propoxyphenyl)iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(4-propoxyphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4662873 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2,4-dichloro-6-[(4-propoxyphenyl)iminomethyl]phenol |
| SMILES | CCCOc1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C16H15Cl2NO2/c1-2-7-21-14-5-3-13(4-6-14)19-10-11-8-12(17)9-15(18)16(11)20/h3-6,8-10,20H,2,7H2,1H3/b19-10+ |
| InChIKey | MKBMDAGZXZEMDJ-VXLYETTFSA-N |
| XLogP | 5.24 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|