C22H26ClNO2 — CID 137211482
2-tert-butyl-4-chloro-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol (PubChem CID 137211482) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol.
| Compound Name | 2-tert-butyl-4-chloro-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137211482 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-tert-butyl-4-chloro-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol |
| SMILES | C=CCCCOc1ccc(/N=C/c2cc(Cl)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-5-6-7-12-26-19-10-8-18(9-11-19)24-15-16-13-17(23)14-20(21(16)25)22(2,3)4/h5,8-11,13-15,25H,1,6-7,12H2,2-4H3/b24-15+ |
| InChIKey | VYVNHRLGYHYYCW-BUVRLJJBSA-N |
| XLogP | 6.44 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|