C21H25NO2 — CID 137225956
2-tert-butyl-4-methyl-6-[(4-prop-2-enoxyphenyl)iminomethyl]phenol (PubChem CID 137225956) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[(4-prop-2-enoxyphenyl)iminomethyl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[(4-prop-2-enoxyphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137225956 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[(4-prop-2-enoxyphenyl)iminomethyl]phenol |
| SMILES | C=CCOc1ccc(/N=C/c2cc(C)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-6-11-24-18-9-7-17(8-10-18)22-14-16-12-15(2)13-19(20(16)23)21(3,4)5/h6-10,12-14,23H,1,11H2,2-5H3/b22-14+ |
| InChIKey | CQIYSOYOGLDPBQ-HYARGMPZSA-N |
| XLogP | 5.31 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|