C20H21NO2 — CID 4575750
1-[2,4-bis(prop-2-enoxy)phenyl]-N-(4-methylphenyl)methanimine (PubChem CID 4575750) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[2,4-bis(prop-2-enoxy)phenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[2,4-bis(prop-2-enoxy)phenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 4575750 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[2,4-bis(prop-2-enoxy)phenyl]-N-(4-methylphenyl)methanimine |
| SMILES | C=CCOc1ccc(/C=N/c2ccc(C)cc2)c(OCC=C)c1 |
| InChI | InChI=1S/C20H21NO2/c1-4-12-22-19-11-8-17(20(14-19)23-13-5-2)15-21-18-9-6-16(3)7-10-18/h4-11,14-15H,1-2,12-13H2,3H3/b21-15+ |
| InChIKey | FTGYOWXHDZLMKL-RCCKNPSSSA-N |
| XLogP | 4.88 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|