C19H20O6 — CID 168600065
5-[[2,4-bis(prop-2-enoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168600065) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 5-[[2,4-bis(prop-2-enoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2,4-bis(prop-2-enoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168600065 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-[[2,4-bis(prop-2-enoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=CCOc1ccc(C=C2C(=O)OC(C)(C)OC2=O)c(OCC=C)c1 |
| InChI | InChI=1S/C19H20O6/c1-5-9-22-14-8-7-13(16(12-14)23-10-6-2)11-15-17(20)24-19(3,4)25-18(15)21/h5-8,11-12H,1-2,9-10H2,3-4H3 |
| InChIKey | LLRVKCPTLFISKM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|