C26H29BO7 — CID 168597904
2,2-dimethyl-5-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168597904) has the molecular formula C26H29BO7 and a molecular weight of 464.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168597904 |
| Molecular Formula | C26H29BO7 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2,2-dimethyl-5-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cc(OCc3ccccc3)ccc2B2OC(C)(C)C(C)(C)O2)C(=O)O1 |
| InChI | InChI=1S/C26H29BO7/c1-24(2)25(3,4)34-27(33-24)21-13-12-19(30-16-17-10-8-7-9-11-17)14-18(21)15-20-22(28)31-26(5,6)32-23(20)29/h7-15H,16H2,1-6H3 |
| InChIKey | LUMMWJPCGWUYJQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|