C24H29BO5 — CID 58248147
ethyl (E)-3-[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate (PubChem CID 58248147) has the molecular formula C24H29BO5 and a molecular weight of 408.30 g/mol. Its IUPAC name is ethyl (E)-3-[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58248147 |
| Molecular Formula | C24H29BO5 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | ethyl (E)-3-[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(OCc2ccccc2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H29BO5/c1-6-27-22(26)15-12-19-16-20(28-17-18-10-8-7-9-11-18)13-14-21(19)25-29-23(2,3)24(4,5)30-25/h7-16H,6,17H2,1-5H3/b15-12+ |
| InChIKey | YFTBRWSLUSOXES-NTCAYCPXSA-N |
| XLogP | 4.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|