C18H25BO4 — CID 135741445
ethyl (E)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate (PubChem CID 135741445) has the molecular formula C18H25BO4 and a molecular weight of 316.21 g/mol. Its IUPAC name is ethyl (E)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135741445 |
| Molecular Formula | C18H25BO4 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl (E)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C |
| InChI | InChI=1S/C18H25BO4/c1-7-21-16(20)11-9-14-8-10-15(12-13(14)2)19-22-17(3,4)18(5,6)23-19/h8-12H,7H2,1-6H3/b11-9+ |
| InChIKey | MMHROXPLEBAVPT-PKNBQFBNSA-N |
| XLogP | 2.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|