C23H26BN3O4S — CID 168574007
2-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574007) has the molecular formula C23H26BN3O4S and a molecular weight of 451.36 g/mol. Its IUPAC name is 2-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574007 |
| Molecular Formula | C23H26BN3O4S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[[5-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1(C)OB(c2ccc(OCc3ccccc3)cc2C=NN=C2NC(=O)CS2)OC1(C)C |
| InChI | InChI=1S/C23H26BN3O4S/c1-22(2)23(3,4)31-24(30-22)19-11-10-18(29-14-16-8-6-5-7-9-16)12-17(19)13-25-27-21-26-20(28)15-32-21/h5-13H,14-15H2,1-4H3,(H,26,27,28) |
| InChIKey | LEJDOXZMMZWLKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|