C17H16O3 — CID 122389437
3,3-dimethyl-5-phenylmethoxy-2-benzofuran-1-one (PubChem CID 122389437) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3,3-dimethyl-5-phenylmethoxy-2-benzofuran-1-one.
| Compound Name | 3,3-dimethyl-5-phenylmethoxy-2-benzofuran-1-one |
|---|---|
| PubChem CID | 122389437 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3,3-dimethyl-5-phenylmethoxy-2-benzofuran-1-one |
| SMILES | CC1(C)OC(=O)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C17H16O3/c1-17(2)15-10-13(8-9-14(15)16(18)20-17)19-11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | DQXDSGWAFKMPFK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |