C17H14F2O2 — CID 170705975
4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-one (PubChem CID 170705975) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-one.
| Compound Name | 4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 170705975 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4,4-difluoro-6-phenylmethoxy-2,3-dihydronaphthalen-1-one |
| SMILES | O=C1CCC(F)(F)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H14F2O2/c18-17(19)9-8-16(20)14-7-6-13(10-15(14)17)21-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | IYKIJJGWUMBQCM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |