C18H15F3O4S — CID 129096575
(6-phenylmethoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 129096575) has the molecular formula C18H15F3O4S and a molecular weight of 384.38 g/mol. Its IUPAC name is (6-phenylmethoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (6-phenylmethoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129096575 |
| Molecular Formula | C18H15F3O4S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (6-phenylmethoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCCc2cc(OCc3ccccc3)ccc21)C(F)(F)F |
| InChI | InChI=1S/C18H15F3O4S/c19-18(20,21)26(22,23)25-17-8-4-7-14-11-15(9-10-16(14)17)24-12-13-5-2-1-3-6-13/h1-3,5-6,8-11H,4,7,12H2 |
| InChIKey | VZQMDKDTFOZBKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|